C13H17IN2O2 — CID 107732213
[3-(1-aminoethyl)pyrrolidin-1-yl]-(2-hydroxy-5-iodophenyl)methanone (PubChem CID 107732213) has the molecular formula C13H17IN2O2 and a molecular weight of 360.20 g/mol. Its IUPAC name is [3-(1-aminoethyl)pyrrolidin-1-yl]-(2-hydroxy-5-iodophenyl)methanone.
| Compound Name | [3-(1-aminoethyl)pyrrolidin-1-yl]-(2-hydroxy-5-iodophenyl)methanone |
|---|---|
| PubChem CID | 107732213 |
| Molecular Formula | C13H17IN2O2 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | [3-(1-aminoethyl)pyrrolidin-1-yl]-(2-hydroxy-5-iodophenyl)methanone |
| SMILES | CC(N)C1CCN(C(=O)c2cc(I)ccc2O)C1 |
| InChI | InChI=1S/C13H17IN2O2/c1-8(15)9-4-5-16(7-9)13(18)11-6-10(14)2-3-12(11)17/h2-3,6,8-9,17H,4-5,7,15H2,1H3 |
| InChIKey | QIIIQKVFQQXKCU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|