C14H16INO2 — CID 113254875
3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-(2-hydroxy-5-iodophenyl)methanone (PubChem CID 113254875) has the molecular formula C14H16INO2 and a molecular weight of 357.19 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-(2-hydroxy-5-iodophenyl)methanone.
| Compound Name | 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-(2-hydroxy-5-iodophenyl)methanone |
|---|---|
| PubChem CID | 113254875 |
| Molecular Formula | C14H16INO2 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-(2-hydroxy-5-iodophenyl)methanone |
| SMILES | O=C(c1cc(I)ccc1O)N1CC2CCCC2C1 |
| InChI | InChI=1S/C14H16INO2/c15-11-4-5-13(17)12(6-11)14(18)16-7-9-2-1-3-10(9)8-16/h4-6,9-10,17H,1-3,7-8H2 |
| InChIKey | MPOSNZXANSPODG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|