C13H15BrINO2 — CID 107732597
[3-(bromomethyl)piperidin-1-yl]-(2-hydroxy-5-iodophenyl)methanone (PubChem CID 107732597) has the molecular formula C13H15BrINO2 and a molecular weight of 424.08 g/mol. Its IUPAC name is [3-(bromomethyl)piperidin-1-yl]-(2-hydroxy-5-iodophenyl)methanone.
| Compound Name | [3-(bromomethyl)piperidin-1-yl]-(2-hydroxy-5-iodophenyl)methanone |
|---|---|
| PubChem CID | 107732597 |
| Molecular Formula | C13H15BrINO2 |
| Molecular Weight | 424.08 g/mol |
| Exact Mass | 422.93 |
| IUPAC Name | [3-(bromomethyl)piperidin-1-yl]-(2-hydroxy-5-iodophenyl)methanone |
| SMILES | O=C(c1cc(I)ccc1O)N1CCCC(CBr)C1 |
| InChI | InChI=1S/C13H15BrINO2/c14-7-9-2-1-5-16(8-9)13(18)11-6-10(15)3-4-12(11)17/h3-4,6,9,17H,1-2,5,7-8H2 |
| InChIKey | UUZQEMNBPZVORE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.08 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|