C14H17BrFNO2 — CID 115299572
[3-(2-bromoethyl)piperidin-1-yl]-(5-fluoro-2-hydroxyphenyl)methanone (PubChem CID 115299572) has the molecular formula C14H17BrFNO2 and a molecular weight of 330.20 g/mol. Its IUPAC name is [3-(2-bromoethyl)piperidin-1-yl]-(5-fluoro-2-hydroxyphenyl)methanone.
| Compound Name | [3-(2-bromoethyl)piperidin-1-yl]-(5-fluoro-2-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 115299572 |
| Molecular Formula | C14H17BrFNO2 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | [3-(2-bromoethyl)piperidin-1-yl]-(5-fluoro-2-hydroxyphenyl)methanone |
| SMILES | O=C(c1cc(F)ccc1O)N1CCCC(CCBr)C1 |
| InChI | InChI=1S/C14H17BrFNO2/c15-6-5-10-2-1-7-17(9-10)14(19)12-8-11(16)3-4-13(12)18/h3-4,8,10,18H,1-2,5-7,9H2 |
| InChIKey | IGGOPMGVCTVNNC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|