C14H15Br2F2NO — CID 80668874
(4-bromo-2,6-difluorophenyl)-[3-(2-bromoethyl)piperidin-1-yl]methanone (PubChem CID 80668874) has the molecular formula C14H15Br2F2NO and a molecular weight of 411.08 g/mol. Its IUPAC name is (4-bromo-2,6-difluorophenyl)-[3-(2-bromoethyl)piperidin-1-yl]methanone.
| Compound Name | (4-bromo-2,6-difluorophenyl)-[3-(2-bromoethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 80668874 |
| Molecular Formula | C14H15Br2F2NO |
| Molecular Weight | 411.08 g/mol |
| Exact Mass | 408.95 |
| IUPAC Name | (4-bromo-2,6-difluorophenyl)-[3-(2-bromoethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1c(F)cc(Br)cc1F)N1CCCC(CCBr)C1 |
| InChI | InChI=1S/C14H15Br2F2NO/c15-4-3-9-2-1-5-19(8-9)14(20)13-11(17)6-10(16)7-12(13)18/h6-7,9H,1-5,8H2 |
| InChIKey | YIHVFRDKFVIWAZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.08 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|