C13H13Br2F2NO — CID 114801576
(4-bromo-2,6-difluorophenyl)-[3-(2-bromoethyl)pyrrolidin-1-yl]methanone (PubChem CID 114801576) has the molecular formula C13H13Br2F2NO and a molecular weight of 397.06 g/mol. Its IUPAC name is (4-bromo-2,6-difluorophenyl)-[3-(2-bromoethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-bromo-2,6-difluorophenyl)-[3-(2-bromoethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 114801576 |
| Molecular Formula | C13H13Br2F2NO |
| Molecular Weight | 397.06 g/mol |
| Exact Mass | 394.93 |
| IUPAC Name | (4-bromo-2,6-difluorophenyl)-[3-(2-bromoethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1c(F)cc(Br)cc1F)N1CCC(CCBr)C1 |
| InChI | InChI=1S/C13H13Br2F2NO/c14-3-1-8-2-4-18(7-8)13(19)12-10(16)5-9(15)6-11(12)17/h5-6,8H,1-4,7H2 |
| InChIKey | OVHHANCVKBVSBZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.06 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|