C13H11BrF5NO — CID 80659023
[3-(bromomethyl)piperidin-1-yl]-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 80659023) has the molecular formula C13H11BrF5NO and a molecular weight of 372.13 g/mol. Its IUPAC name is [3-(bromomethyl)piperidin-1-yl]-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | [3-(bromomethyl)piperidin-1-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 80659023 |
| Molecular Formula | C13H11BrF5NO |
| Molecular Weight | 372.13 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | [3-(bromomethyl)piperidin-1-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)N1CCCC(CBr)C1 |
| InChI | InChI=1S/C13H11BrF5NO/c14-4-6-2-1-3-20(5-6)13(21)7-8(15)10(17)12(19)11(18)9(7)16/h6H,1-5H2 |
| InChIKey | MDCZLPLJNLGDTH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.13 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|