C11H8F5NO — CID 2169089
(2,3,4,5,6-pentafluorophenyl)-pyrrolidin-1-ylmethanone (PubChem CID 2169089) has the molecular formula C11H8F5NO and a molecular weight of 265.18 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)-pyrrolidin-1-ylmethanone.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 2169089 |
| Molecular Formula | C11H8F5NO |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)N1CCCC1 |
| InChI | InChI=1S/C11H8F5NO/c12-6-5(11(18)17-3-1-2-4-17)7(13)9(15)10(16)8(6)14/h1-4H2 |
| InChIKey | ARQJMKHZRCJNBT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|