C21H27N3O3 — CID 171722697
[3,5-bis(pyrrolidine-1-carbonyl)phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 171722697) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is [3,5-bis(pyrrolidine-1-carbonyl)phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3,5-bis(pyrrolidine-1-carbonyl)phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 171722697 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [3,5-bis(pyrrolidine-1-carbonyl)phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cc(C(=O)N2CCCC2)cc(C(=O)N2CCCC2)c1)N1CCCC1 |
| InChI | InChI=1S/C21H27N3O3/c25-19(22-7-1-2-8-22)16-13-17(20(26)23-9-3-4-10-23)15-18(14-16)21(27)24-11-5-6-12-24/h13-15H,1-12H2 |
| InChIKey | MVFHNBNUGNZKFI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |