C14H13Cl2NO3 — CID 156548712
5-(piperidine-1-carbonyl)benzene-1,3-dicarbonyl chloride (PubChem CID 156548712) has the molecular formula C14H13Cl2NO3 and a molecular weight of 314.17 g/mol. Its IUPAC name is 5-(piperidine-1-carbonyl)benzene-1,3-dicarbonyl chloride.
| Compound Name | 5-(piperidine-1-carbonyl)benzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 156548712 |
| Molecular Formula | C14H13Cl2NO3 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 5-(piperidine-1-carbonyl)benzene-1,3-dicarbonyl chloride |
| SMILES | O=C(Cl)c1cc(C(=O)Cl)cc(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C14H13Cl2NO3/c15-12(18)9-6-10(13(16)19)8-11(7-9)14(20)17-4-2-1-3-5-17/h6-8H,1-5H2 |
| InChIKey | YODKVXOMGGLSMD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|