C15H15N3O3 — CID 27654
aziridin-1-yl-[3,5-bis(aziridine-1-carbonyl)phenyl]methanone (PubChem CID 27654) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is aziridin-1-yl-[3,5-bis(aziridine-1-carbonyl)phenyl]methanone.
| Compound Name | aziridin-1-yl-[3,5-bis(aziridine-1-carbonyl)phenyl]methanone |
|---|---|
| PubChem CID | 27654 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | aziridin-1-yl-[3,5-bis(aziridine-1-carbonyl)phenyl]methanone |
| SMILES | O=C(c1cc(C(=O)N2CC2)cc(C(=O)N2CC2)c1)N1CC1 |
| InChI | InChI=1S/C15H15N3O3/c19-13(16-1-2-16)10-7-11(14(20)17-3-4-17)9-12(8-10)15(21)18-5-6-18/h7-9H,1-6H2 |
| InChIKey | LSNKTNHLGDDMLJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 60.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|