C18H22N6O2 — CID 58291381
[4-(3,5-diaminobenzoyl)piperazin-1-yl]-(3,5-diaminophenyl)methanone (PubChem CID 58291381) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is [4-(3,5-diaminobenzoyl)piperazin-1-yl]-(3,5-diaminophenyl)methanone.
| Compound Name | [4-(3,5-diaminobenzoyl)piperazin-1-yl]-(3,5-diaminophenyl)methanone |
|---|---|
| PubChem CID | 58291381 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | [4-(3,5-diaminobenzoyl)piperazin-1-yl]-(3,5-diaminophenyl)methanone |
| SMILES | Nc1cc(N)cc(C(=O)N2CCN(C(=O)c3cc(N)cc(N)c3)CC2)c1 |
| InChI | InChI=1S/C18H22N6O2/c19-13-5-11(6-14(20)9-13)17(25)23-1-2-24(4-3-23)18(26)12-7-15(21)10-16(22)8-12/h5-10H,1-4,19-22H2 |
| InChIKey | LRMMFKRRVQMXFF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 144.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|