C17H20FN3O2 — CID 143923093
(3,5-diaminophenyl)-pyrrolidin-1-ylmethanone;2-fluorophenol (PubChem CID 143923093) has the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. Its IUPAC name is (3,5-diaminophenyl)-pyrrolidin-1-ylmethanone;2-fluorophenol.
| Compound Name | (3,5-diaminophenyl)-pyrrolidin-1-ylmethanone;2-fluorophenol |
|---|---|
| PubChem CID | 143923093 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (3,5-diaminophenyl)-pyrrolidin-1-ylmethanone;2-fluorophenol |
| SMILES | Nc1cc(N)cc(C(=O)N2CCCC2)c1.Oc1ccccc1F |
| InChI | InChI=1S/C11H15N3O.C6H5FO/c12-9-5-8(6-10(13)7-9)11(15)14-3-1-2-4-14;7-5-3-1-2-4-6(5)8/h5-7H,1-4,12-13H2;1-4,8H |
| InChIKey | CYOJNRREOUYONL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|