C15H15NO2 — CID 82372380
(4-hydroxynaphthalen-2-yl)-pyrrolidin-1-ylmethanone (PubChem CID 82372380) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is (4-hydroxynaphthalen-2-yl)-pyrrolidin-1-ylmethanone.
| Compound Name | (4-hydroxynaphthalen-2-yl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 82372380 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (4-hydroxynaphthalen-2-yl)-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cc(O)c2ccccc2c1)N1CCCC1 |
| InChI | InChI=1S/C15H15NO2/c17-14-10-12(15(18)16-7-3-4-8-16)9-11-5-1-2-6-13(11)14/h1-2,5-6,9-10,17H,3-4,7-8H2 |
| InChIKey | DDYUOPBGPKWGBW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |