C20H22N2O5 — CID 108545755
(2-methylphenyl)-[4-(3,4,5-trihydroxybenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 108545755) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is (2-methylphenyl)-[4-(3,4,5-trihydroxybenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (2-methylphenyl)-[4-(3,4,5-trihydroxybenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 108545755 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (2-methylphenyl)-[4-(3,4,5-trihydroxybenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1ccccc1C(=O)N1CCCN(C(=O)c2cc(O)c(O)c(O)c2)CC1 |
| InChI | InChI=1S/C20H22N2O5/c1-13-5-2-3-6-15(13)20(27)22-8-4-7-21(9-10-22)19(26)14-11-16(23)18(25)17(24)12-14/h2-3,5-6,11-12,23-25H,4,7-10H2,1H3 |
| InChIKey | NUSPNJGRGJRLBB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|