C21H24N2O7 — CID 108544510
[4-(2,6-dimethoxybenzoyl)-1,4-diazepan-1-yl]-(3,4,5-trihydroxyphenyl)methanone (PubChem CID 108544510) has the molecular formula C21H24N2O7 and a molecular weight of 416.43 g/mol. Its IUPAC name is [4-(2,6-dimethoxybenzoyl)-1,4-diazepan-1-yl]-(3,4,5-trihydroxyphenyl)methanone.
| Compound Name | [4-(2,6-dimethoxybenzoyl)-1,4-diazepan-1-yl]-(3,4,5-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 108544510 |
| Molecular Formula | C21H24N2O7 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [4-(2,6-dimethoxybenzoyl)-1,4-diazepan-1-yl]-(3,4,5-trihydroxyphenyl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)N1CCCN(C(=O)c2cc(O)c(O)c(O)c2)CC1 |
| InChI | InChI=1S/C21H24N2O7/c1-29-16-5-3-6-17(30-2)18(16)21(28)23-8-4-7-22(9-10-23)20(27)13-11-14(24)19(26)15(25)12-13/h3,5-6,11-12,24-26H,4,7-10H2,1-2H3 |
| InChIKey | GCKWPVZFVKPHMN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|