C20H23N3O2 — CID 120622945
[4-(5-amino-2-methylbenzoyl)-1,4-diazepan-1-yl]-phenylmethanone (PubChem CID 120622945) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is [4-(5-amino-2-methylbenzoyl)-1,4-diazepan-1-yl]-phenylmethanone.
| Compound Name | [4-(5-amino-2-methylbenzoyl)-1,4-diazepan-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 120622945 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | [4-(5-amino-2-methylbenzoyl)-1,4-diazepan-1-yl]-phenylmethanone |
| SMILES | Cc1ccc(N)cc1C(=O)N1CCCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N3O2/c1-15-8-9-17(21)14-18(15)20(25)23-11-5-10-22(12-13-23)19(24)16-6-3-2-4-7-16/h2-4,6-9,14H,5,10-13,21H2,1H3 |
| InChIKey | CXYJTJOKUYFCPW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|