C19H19F2N3O2 — CID 120626677
(5-amino-2-methylphenyl)-[4-(2,6-difluorobenzoyl)piperazin-1-yl]methanone (PubChem CID 120626677) has the molecular formula C19H19F2N3O2 and a molecular weight of 359.38 g/mol. Its IUPAC name is (5-amino-2-methylphenyl)-[4-(2,6-difluorobenzoyl)piperazin-1-yl]methanone.
| Compound Name | (5-amino-2-methylphenyl)-[4-(2,6-difluorobenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 120626677 |
| Molecular Formula | C19H19F2N3O2 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (5-amino-2-methylphenyl)-[4-(2,6-difluorobenzoyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(N)cc1C(=O)N1CCN(C(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C19H19F2N3O2/c1-12-5-6-13(22)11-14(12)18(25)23-7-9-24(10-8-23)19(26)17-15(20)3-2-4-16(17)21/h2-6,11H,7-10,22H2,1H3 |
| InChIKey | FRKIJQXYCXUHIK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|