C20H27Cl2N3O — CID 120640078
(5-amino-2-methylphenyl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone;dihydrochloride (PubChem CID 120640078) has the molecular formula C20H27Cl2N3O and a molecular weight of 396.36 g/mol. Its IUPAC name is (5-amino-2-methylphenyl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (5-amino-2-methylphenyl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 120640078 |
| Molecular Formula | C20H27Cl2N3O |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (5-amino-2-methylphenyl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone;dihydrochloride |
| SMILES | Cc1cccc(CN2CCN(C(=O)c3cc(N)ccc3C)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C20H25N3O.2ClH/c1-15-4-3-5-17(12-15)14-22-8-10-23(11-9-22)20(24)19-13-18(21)7-6-16(19)2;;/h3-7,12-13H,8-11,14,21H2,1-2H3;2*1H |
| InChIKey | GGGYYPDHROLHIA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|