C18H24N4O2 — CID 120646222
(5-amino-2-methylphenyl)-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]methanone (PubChem CID 120646222) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (5-amino-2-methylphenyl)-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (5-amino-2-methylphenyl)-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 120646222 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (5-amino-2-methylphenyl)-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1ccc(N)cc1C(=O)N1CCN(Cc2nc(C)c(C)o2)CC1 |
| InChI | InChI=1S/C18H24N4O2/c1-12-4-5-15(19)10-16(12)18(23)22-8-6-21(7-9-22)11-17-20-13(2)14(3)24-17/h4-5,10H,6-9,11,19H2,1-3H3 |
| InChIKey | QKHDZAIYZJFBEK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|