C20H25N3O2 — CID 98479498
(E)-1-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-3-phenylbut-2-en-1-one (PubChem CID 98479498) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (E)-1-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-3-phenylbut-2-en-1-one.
| Compound Name | (E)-1-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-3-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 98479498 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | (E)-1-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-3-phenylbut-2-en-1-one |
| SMILES | C/C(=C\C(=O)N1CCN(Cc2nc(C)c(C)o2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O2/c1-15(18-7-5-4-6-8-18)13-20(24)23-11-9-22(10-12-23)14-19-21-16(2)17(3)25-19/h4-8,13H,9-12,14H2,1-3H3/b15-13+ |
| InChIKey | PZRVIRKZMWKOIC-FYWRMAATSA-N |
| XLogP | 3.04 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|