C20H23F2N3O — CID 120646250
(5-amino-2-methylphenyl)-[4-[1-(2,4-difluorophenyl)ethyl]piperazin-1-yl]methanone (PubChem CID 120646250) has the molecular formula C20H23F2N3O and a molecular weight of 359.42 g/mol. Its IUPAC name is (5-amino-2-methylphenyl)-[4-[1-(2,4-difluorophenyl)ethyl]piperazin-1-yl]methanone.
| Compound Name | (5-amino-2-methylphenyl)-[4-[1-(2,4-difluorophenyl)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 120646250 |
| Molecular Formula | C20H23F2N3O |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (5-amino-2-methylphenyl)-[4-[1-(2,4-difluorophenyl)ethyl]piperazin-1-yl]methanone |
| SMILES | Cc1ccc(N)cc1C(=O)N1CCN(C(C)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C20H23F2N3O/c1-13-3-5-16(23)12-18(13)20(26)25-9-7-24(8-10-25)14(2)17-6-4-15(21)11-19(17)22/h3-6,11-12,14H,7-10,23H2,1-2H3 |
| InChIKey | WRJXROLAAWBYTN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|