C18H20F2N2O — CID 120638122
5-amino-N-[1-(2,4-difluorophenyl)-2-methylpropyl]-2-methylbenzamide (PubChem CID 120638122) has the molecular formula C18H20F2N2O and a molecular weight of 318.37 g/mol. Its IUPAC name is 5-amino-N-[1-(2,4-difluorophenyl)-2-methylpropyl]-2-methylbenzamide.
| Compound Name | 5-amino-N-[1-(2,4-difluorophenyl)-2-methylpropyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 120638122 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 5-amino-N-[1-(2,4-difluorophenyl)-2-methylpropyl]-2-methylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)NC(c1ccc(F)cc1F)C(C)C |
| InChI | InChI=1S/C18H20F2N2O/c1-10(2)17(14-7-5-12(19)8-16(14)20)22-18(23)15-9-13(21)6-4-11(15)3/h4-10,17H,21H2,1-3H3,(H,22,23) |
| InChIKey | YOHBHMHRMNLHSE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|