C22H27N3O2 — CID 120629543
1-[4-(5-amino-2-methylbenzoyl)piperazin-1-yl]-4-phenylbutan-1-one (PubChem CID 120629543) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-[4-(5-amino-2-methylbenzoyl)piperazin-1-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[4-(5-amino-2-methylbenzoyl)piperazin-1-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 120629543 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-[4-(5-amino-2-methylbenzoyl)piperazin-1-yl]-4-phenylbutan-1-one |
| SMILES | Cc1ccc(N)cc1C(=O)N1CCN(C(=O)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27N3O2/c1-17-10-11-19(23)16-20(17)22(27)25-14-12-24(13-15-25)21(26)9-5-8-18-6-3-2-4-7-18/h2-4,6-7,10-11,16H,5,8-9,12-15,23H2,1H3 |
| InChIKey | BMYXHLMFAFEMKL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|