C22H26N2O2 — CID 48866980
1-[4-(3,4-dimethylbenzoyl)piperazin-1-yl]-3-phenylpropan-1-one (PubChem CID 48866980) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-[4-(3,4-dimethylbenzoyl)piperazin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[4-(3,4-dimethylbenzoyl)piperazin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 48866980 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-[4-(3,4-dimethylbenzoyl)piperazin-1-yl]-3-phenylpropan-1-one |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)CCc3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C22H26N2O2/c1-17-8-10-20(16-18(17)2)22(26)24-14-12-23(13-15-24)21(25)11-9-19-6-4-3-5-7-19/h3-8,10,16H,9,11-15H2,1-2H3 |
| InChIKey | PUJCXFTVRQGFOX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |