C22H28ClN3O2 — CID 119444703
1-[4-[2-(4-aminophenyl)acetyl]piperazin-1-yl]-4-phenylbutan-1-one;hydrochloride (PubChem CID 119444703) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is 1-[4-[2-(4-aminophenyl)acetyl]piperazin-1-yl]-4-phenylbutan-1-one;hydrochloride.
| Compound Name | 1-[4-[2-(4-aminophenyl)acetyl]piperazin-1-yl]-4-phenylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119444703 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-[4-[2-(4-aminophenyl)acetyl]piperazin-1-yl]-4-phenylbutan-1-one;hydrochloride |
| SMILES | Cl.Nc1ccc(CC(=O)N2CCN(C(=O)CCCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O2.ClH/c23-20-11-9-19(10-12-20)17-22(27)25-15-13-24(14-16-25)21(26)8-4-7-18-5-2-1-3-6-18;/h1-3,5-6,9-12H,4,7-8,13-17,23H2;1H |
| InChIKey | SLWUNDQQUJZTCT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|