C21H27ClN2O — CID 119811821
2-(4-aminophenyl)-1-[3-methyl-3-(2-phenylethyl)pyrrolidin-1-yl]ethanone;hydrochloride (PubChem CID 119811821) has the molecular formula C21H27ClN2O and a molecular weight of 358.91 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[3-methyl-3-(2-phenylethyl)pyrrolidin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-1-[3-methyl-3-(2-phenylethyl)pyrrolidin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119811821 |
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2-(4-aminophenyl)-1-[3-methyl-3-(2-phenylethyl)pyrrolidin-1-yl]ethanone;hydrochloride |
| SMILES | CC1(CCc2ccccc2)CCN(C(=O)Cc2ccc(N)cc2)C1.Cl |
| InChI | InChI=1S/C21H26N2O.ClH/c1-21(12-11-17-5-3-2-4-6-17)13-14-23(16-21)20(24)15-18-7-9-19(22)10-8-18;/h2-10H,11-16,22H2,1H3;1H |
| InChIKey | RQOFBOSLOGVHJU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|