C19H25Cl2N3O — CID 119860765
2-(4-aminophenyl)-1-(4-phenyl-1,4-diazepan-1-yl)ethanone;dihydrochloride (PubChem CID 119860765) has the molecular formula C19H25Cl2N3O and a molecular weight of 382.33 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-(4-phenyl-1,4-diazepan-1-yl)ethanone;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-1-(4-phenyl-1,4-diazepan-1-yl)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119860765 |
| Molecular Formula | C19H25Cl2N3O |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-(4-aminophenyl)-1-(4-phenyl-1,4-diazepan-1-yl)ethanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CC(=O)N2CCCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H23N3O.2ClH/c20-17-9-7-16(8-10-17)15-19(23)22-12-4-11-21(13-14-22)18-5-2-1-3-6-18;;/h1-3,5-10H,4,11-15,20H2;2*1H |
| InChIKey | ZAJNYGDCVNHCJB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|