C20H23ClFN3O2 — CID 119710397
2-(4-aminophenyl)-1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]ethanone;hydrochloride (PubChem CID 119710397) has the molecular formula C20H23ClFN3O2 and a molecular weight of 391.87 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119710397 |
| Molecular Formula | C20H23ClFN3O2 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-(4-aminophenyl)-1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]ethanone;hydrochloride |
| SMILES | Cl.Nc1ccc(CC(=O)N2CCCN(C(=O)c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C20H22FN3O2.ClH/c21-18-5-2-1-4-17(18)20(26)24-11-3-10-23(12-13-24)19(25)14-15-6-8-16(22)9-7-15;/h1-2,4-9H,3,10-14,22H2;1H |
| InChIKey | VDLDOLKTLMOMAB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|