C24H23FN2O2 — CID 78849758
1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-naphthalen-1-ylethanone (PubChem CID 78849758) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-naphthalen-1-ylethanone.
| Compound Name | 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-naphthalen-1-ylethanone |
|---|---|
| PubChem CID | 78849758 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-naphthalen-1-ylethanone |
| SMILES | O=C(Cc1cccc2ccccc12)N1CCCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C24H23FN2O2/c25-22-12-4-3-11-21(22)24(29)27-14-6-13-26(15-16-27)23(28)17-19-9-5-8-18-7-1-2-10-20(18)19/h1-5,7-12H,6,13-17H2 |
| InChIKey | IMADVYJPMUJZSP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |