C23H24FN3O2 — CID 78852452
1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-(2-methyl-1H-indol-3-yl)ethanone (PubChem CID 78852452) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-(2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-(2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 78852452 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-(2-methyl-1H-indol-3-yl)ethanone |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)N1CCCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H24FN3O2/c1-16-19(17-7-3-5-10-21(17)25-16)15-22(28)26-11-6-12-27(14-13-26)23(29)18-8-2-4-9-20(18)24/h2-5,7-10,25H,6,11-15H2,1H3 |
| InChIKey | QIUQDVAMHIMVJS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|