C20H22N4O — CID 31955040
2-(2-methyl-1H-indol-3-yl)-1-(4-pyridin-4-ylpiperazin-1-yl)ethanone (PubChem CID 31955040) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-(2-methyl-1H-indol-3-yl)-1-(4-pyridin-4-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-(2-methyl-1H-indol-3-yl)-1-(4-pyridin-4-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 31955040 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-(2-methyl-1H-indol-3-yl)-1-(4-pyridin-4-ylpiperazin-1-yl)ethanone |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)N1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C20H22N4O/c1-15-18(17-4-2-3-5-19(17)22-15)14-20(25)24-12-10-23(11-13-24)16-6-8-21-9-7-16/h2-9,22H,10-14H2,1H3 |
| InChIKey | FDRLPXKMLDFFJA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|