C23H23ClFN3O2 — CID 86832887
1-[4-(2-chlorobenzoyl)-1,4-diazepan-1-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone (PubChem CID 86832887) has the molecular formula C23H23ClFN3O2 and a molecular weight of 427.91 g/mol. Its IUPAC name is 1-[4-(2-chlorobenzoyl)-1,4-diazepan-1-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-[4-(2-chlorobenzoyl)-1,4-diazepan-1-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 86832887 |
| Molecular Formula | C23H23ClFN3O2 |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-[4-(2-chlorobenzoyl)-1,4-diazepan-1-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N1CCCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C23H23ClFN3O2/c1-15-18(19-13-16(25)7-8-21(19)26-15)14-22(29)27-9-4-10-28(12-11-27)23(30)17-5-2-3-6-20(17)24/h2-3,5-8,13,26H,4,9-12,14H2,1H3 |
| InChIKey | GYFQZGSRGHQRLU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|