C19H17FN2OS — CID 55589450
1-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone (PubChem CID 55589450) has the molecular formula C19H17FN2OS and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 55589450 |
| Molecular Formula | C19H17FN2OS |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzothiazin-4-yl)-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N1CCSc2ccccc21 |
| InChI | InChI=1S/C19H17FN2OS/c1-12-14(15-10-13(20)6-7-16(15)21-12)11-19(23)22-8-9-24-18-5-3-2-4-17(18)22/h2-7,10,21H,8-9,11H2,1H3 |
| InChIKey | LIVKJCXUALTNQP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|