C23H26FN3O2 — CID 86905280
2-(5-fluoro-2-methyl-1H-indol-3-yl)-1-[4-(2-hydroxy-2-phenylethyl)piperazin-1-yl]ethanone (PubChem CID 86905280) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-(5-fluoro-2-methyl-1H-indol-3-yl)-1-[4-(2-hydroxy-2-phenylethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-1-[4-(2-hydroxy-2-phenylethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 86905280 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-1-[4-(2-hydroxy-2-phenylethyl)piperazin-1-yl]ethanone |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N1CCN(CC(O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26FN3O2/c1-16-19(20-13-18(24)7-8-21(20)25-16)14-23(29)27-11-9-26(10-12-27)15-22(28)17-5-3-2-4-6-17/h2-8,13,22,25,28H,9-12,14-15H2,1H3 |
| InChIKey | XFBPTSAICWUVOP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|