C17H19FN2O4 — CID 165417203
(3R,4R)-1-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-4-hydroxypiperidine-3-carboxylic acid (PubChem CID 165417203) has the molecular formula C17H19FN2O4 and a molecular weight of 334.35 g/mol. Its IUPAC name is (3R,4R)-1-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-4-hydroxypiperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-4-hydroxypiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 165417203 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (3R,4R)-1-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-4-hydroxypiperidine-3-carboxylic acid |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N1CC[C@@H](O)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C17H19FN2O4/c1-9-11(12-6-10(18)2-3-14(12)19-9)7-16(22)20-5-4-15(21)13(8-20)17(23)24/h2-3,6,13,15,19,21H,4-5,7-8H2,1H3,(H,23,24)/t13-,15-/m1/s1 |
| InChIKey | FENKMUNEMUXHFY-UKRRQHHQSA-N |
| XLogP | 1.45 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|