C19H23FN2O3 — CID 137335894
1-[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone (PubChem CID 137335894) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 137335894 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N1C[C@@H]2COCC[C@]2(CO)C1 |
| InChI | InChI=1S/C19H23FN2O3/c1-12-15(16-6-14(20)2-3-17(16)21-12)7-18(24)22-8-13-9-25-5-4-19(13,10-22)11-23/h2-3,6,13,21,23H,4-5,7-11H2,1H3/t13-,19-/m1/s1 |
| InChIKey | KEJNQSJINDZFDR-BFUOFWGJSA-N |
| XLogP | 2.02 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|