C19H20FN3O3 — CID 154816048
(1S,8R)-9-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one (PubChem CID 154816048) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is (1S,8R)-9-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one.
| Compound Name | (1S,8R)-9-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one |
|---|---|
| PubChem CID | 154816048 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (1S,8R)-9-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N1CC[C@@]23OCCN2C(=O)C[C@@H]13 |
| InChI | InChI=1S/C19H20FN3O3/c1-11-13(14-8-12(20)2-3-15(14)21-11)9-17(24)22-5-4-19-16(22)10-18(25)23(19)6-7-26-19/h2-3,8,16,21H,4-7,9-10H2,1H3/t16-,19+/m1/s1 |
| InChIKey | KQFLJJFCDMMJSQ-APWZRJJASA-N |
| XLogP | 1.72 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|