C22H20FN3OS — CID 134005126
1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone (PubChem CID 134005126) has the molecular formula C22H20FN3OS and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 134005126 |
| Molecular Formula | C22H20FN3OS |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N1CCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H20FN3OS/c1-13-15(16-11-14(23)8-9-17(16)24-13)12-21(27)26-10-4-6-19(26)22-25-18-5-2-3-7-20(18)28-22/h2-3,5,7-9,11,19,24H,4,6,10,12H2,1H3 |
| InChIKey | NWTPDTTUMFHKBF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|