C19H20FN3OS — CID 86957499
2-(5-fluoro-2-methyl-1H-indol-3-yl)-1-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethanone (PubChem CID 86957499) has the molecular formula C19H20FN3OS and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-(5-fluoro-2-methyl-1H-indol-3-yl)-1-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-1-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 86957499 |
| Molecular Formula | C19H20FN3OS |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-1-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethanone |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N1CCCCC1c1nccs1 |
| InChI | InChI=1S/C19H20FN3OS/c1-12-14(15-10-13(20)5-6-16(15)22-12)11-18(24)23-8-3-2-4-17(23)19-21-7-9-25-19/h5-7,9-10,17,22H,2-4,8,11H2,1H3 |
| InChIKey | IZPZCJWYVHKKEQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|