C9H13N3OS — CID 66584691
2-(1,3-thiazol-2-yl)piperidine-1-carboxamide (PubChem CID 66584691) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)piperidine-1-carboxamide.
| Compound Name | 2-(1,3-thiazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 66584691 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCCCC1c1nccs1 |
| InChI | InChI=1S/C9H13N3OS/c10-9(13)12-5-2-1-3-7(12)8-11-4-6-14-8/h4,6-7H,1-3,5H2,(H2,10,13) |
| InChIKey | BUDLLCZBERLSNT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |