C14H20N2O2S — CID 58171477
cyclohexyl 2-(1,3-thiazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 58171477) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is cyclohexyl 2-(1,3-thiazol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | cyclohexyl 2-(1,3-thiazol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58171477 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | cyclohexyl 2-(1,3-thiazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | O=C(OC1CCCCC1)N1CCCC1c1nccs1 |
| InChI | InChI=1S/C14H20N2O2S/c17-14(18-11-5-2-1-3-6-11)16-9-4-7-12(16)13-15-8-10-19-13/h8,10-12H,1-7,9H2 |
| InChIKey | FFZSSRXLFSBVLA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |