methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate

C12H16N2O3S — CID 110750323

IUPACmethyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate
SMILESCOC(=O)CCC(=O)N1CCCC1c1nccs1
InChIInChI=1S/C12H16N2O3S/c1-17-11(16)5-4-10(15)14-7-2-3-9(14)12-13-6-8-18-12/h6,8-9H,2-5,7H2,1H3
InChIKeyWWWKOLKJOZQYII-UHFFFAOYSA-N
MW268.34 g/mol
LogP1.76
Rot. Bonds4

About methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate

methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate (PubChem CID 110750323) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate.

Molecular Properties

Compound Namemethyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate
PubChem CID110750323
Molecular FormulaC12H16N2O3S
Molecular Weight268.34 g/mol
Exact Mass268.09
IUPAC Namemethyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate
SMILESCOC(=O)CCC(=O)N1CCCC1c1nccs1
InChIInChI=1S/C12H16N2O3S/c1-17-11(16)5-4-10(15)14-7-2-3-9(14)12-13-6-8-18-12/h6,8-9H,2-5,7H2,1H3
InChIKeyWWWKOLKJOZQYII-UHFFFAOYSA-N
XLogP1.76
TPSA59.50 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.34
LogP ≤ 51.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate?
The IUPAC name of methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate (CID 110750323) is methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate.
What is the SMILES notation for methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate?
The canonical SMILES for methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate is COC(=O)CCC(=O)N1CCCC1c1nccs1.
What is the InChIKey of methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate?
The InChIKey is WWWKOLKJOZQYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3S/c1-17-11(16)5-4-10(15)14-7-2-3-9(14)12-13-6-8-18-12/h6,8-9H,2-5,7H2,1H3.
What are the key properties of methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate?
methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate has a molecular weight of 268.34 g/mol, XLogP of 1.76, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butanoate is sourced from PubChem (CID 110750323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).