C21H22N6OS2 — CID 41367930
1-[(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone (PubChem CID 41367930) has the molecular formula C21H22N6OS2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 1-[(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone.
| Compound Name | 1-[(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone |
|---|---|
| PubChem CID | 41367930 |
| Molecular Formula | C21H22N6OS2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 1-[(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone |
| SMILES | CSc1nc2nc(C)c(CC(=O)N3CCC[C@H]3c3nc4ccccc4s3)c(C)n2n1 |
| InChI | InChI=1S/C21H22N6OS2/c1-12-14(13(2)27-20(22-12)24-21(25-27)29-3)11-18(28)26-10-6-8-16(26)19-23-15-7-4-5-9-17(15)30-19/h4-5,7,9,16H,6,8,10-11H2,1-3H3/t16-/m0/s1 |
| InChIKey | PXTLXNPYGNWTIR-INIZCTEOSA-N |
| XLogP | 3.98 |
| TPSA | 76.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |