C18H24FN3O — CID 96513025
1-[(3R,4S)-3-(dimethylamino)-4-methylpyrrolidin-1-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone (PubChem CID 96513025) has the molecular formula C18H24FN3O and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-[(3R,4S)-3-(dimethylamino)-4-methylpyrrolidin-1-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-[(3R,4S)-3-(dimethylamino)-4-methylpyrrolidin-1-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 96513025 |
| Molecular Formula | C18H24FN3O |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-[(3R,4S)-3-(dimethylamino)-4-methylpyrrolidin-1-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanone |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N1C[C@H](C)[C@@H](N(C)C)C1 |
| InChI | InChI=1S/C18H24FN3O/c1-11-9-22(10-17(11)21(3)4)18(23)8-14-12(2)20-16-6-5-13(19)7-15(14)16/h5-7,11,17,20H,8-10H2,1-4H3/t11-,17-/m0/s1 |
| InChIKey | AELMALYIYGXQEV-GTNSWQLSSA-N |
| XLogP | 2.57 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|