C21H21FN2O3S — CID 99787777
methyl (3S,4S)-1-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-4-thiophen-3-ylpyrrolidine-3-carboxylate (PubChem CID 99787777) has the molecular formula C21H21FN2O3S and a molecular weight of 400.48 g/mol. Its IUPAC name is methyl (3S,4S)-1-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-4-thiophen-3-ylpyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,4S)-1-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-4-thiophen-3-ylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 99787777 |
| Molecular Formula | C21H21FN2O3S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | methyl (3S,4S)-1-[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]-4-thiophen-3-ylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CN(C(=O)Cc2c(C)[nH]c3ccc(F)cc23)C[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C21H21FN2O3S/c1-12-15(16-7-14(22)3-4-19(16)23-12)8-20(25)24-9-17(13-5-6-28-11-13)18(10-24)21(26)27-2/h3-7,11,17-18,23H,8-10H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | ZZLIUXFGGYDWOT-QZTJIDSGSA-N |
| XLogP | 3.63 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|