C22H24ClFN2O2 — CID 86961991
1-[4-(2-chlorobenzoyl)-1,4-diazepan-1-yl]-3-(3-fluorophenyl)butan-1-one (PubChem CID 86961991) has the molecular formula C22H24ClFN2O2 and a molecular weight of 402.90 g/mol. Its IUPAC name is 1-[4-(2-chlorobenzoyl)-1,4-diazepan-1-yl]-3-(3-fluorophenyl)butan-1-one.
| Compound Name | 1-[4-(2-chlorobenzoyl)-1,4-diazepan-1-yl]-3-(3-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 86961991 |
| Molecular Formula | C22H24ClFN2O2 |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-[4-(2-chlorobenzoyl)-1,4-diazepan-1-yl]-3-(3-fluorophenyl)butan-1-one |
| SMILES | CC(CC(=O)N1CCCN(C(=O)c2ccccc2Cl)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H24ClFN2O2/c1-16(17-6-4-7-18(24)15-17)14-21(27)25-10-5-11-26(13-12-25)22(28)19-8-2-3-9-20(19)23/h2-4,6-9,15-16H,5,10-14H2,1H3 |
| InChIKey | KRHNYVGJVMRHJE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |