C18H26FN3O2 — CID 119480418
N-(2-aminoethyl)-1-[3-(3-fluorophenyl)butanoyl]piperidine-3-carboxamide (PubChem CID 119480418) has the molecular formula C18H26FN3O2 and a molecular weight of 335.42 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[3-(3-fluorophenyl)butanoyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[3-(3-fluorophenyl)butanoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119480418 |
| Molecular Formula | C18H26FN3O2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-(2-aminoethyl)-1-[3-(3-fluorophenyl)butanoyl]piperidine-3-carboxamide |
| SMILES | CC(CC(=O)N1CCCC(C(=O)NCCN)C1)c1cccc(F)c1 |
| InChI | InChI=1S/C18H26FN3O2/c1-13(14-4-2-6-16(19)11-14)10-17(23)22-9-3-5-15(12-22)18(24)21-8-7-20/h2,4,6,11,13,15H,3,5,7-10,12,20H2,1H3,(H,21,24) |
| InChIKey | YHWDLCDOTFXCCI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |