C17H24FN3O2S — CID 119480930
N-(2-aminoethyl)-1-[3-(2-fluorophenyl)sulfanylpropanoyl]piperidine-3-carboxamide (PubChem CID 119480930) has the molecular formula C17H24FN3O2S and a molecular weight of 353.46 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[3-(2-fluorophenyl)sulfanylpropanoyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[3-(2-fluorophenyl)sulfanylpropanoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119480930 |
| Molecular Formula | C17H24FN3O2S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-(2-aminoethyl)-1-[3-(2-fluorophenyl)sulfanylpropanoyl]piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(C(=O)CCSc2ccccc2F)C1 |
| InChI | InChI=1S/C17H24FN3O2S/c18-14-5-1-2-6-15(14)24-11-7-16(22)21-10-3-4-13(12-21)17(23)20-9-8-19/h1-2,5-6,13H,3-4,7-12,19H2,(H,20,23) |
| InChIKey | BNYDPWHUDVDLEP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |