C13H17FN2OS — CID 119411466
1-[(3R)-3-aminopyrrolidin-1-yl]-3-(2-fluorophenyl)sulfanylpropan-1-one (PubChem CID 119411466) has the molecular formula C13H17FN2OS and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[(3R)-3-aminopyrrolidin-1-yl]-3-(2-fluorophenyl)sulfanylpropan-1-one.
| Compound Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-3-(2-fluorophenyl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 119411466 |
| Molecular Formula | C13H17FN2OS |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-3-(2-fluorophenyl)sulfanylpropan-1-one |
| SMILES | N[C@@H]1CCN(C(=O)CCSc2ccccc2F)C1 |
| InChI | InChI=1S/C13H17FN2OS/c14-11-3-1-2-4-12(11)18-8-6-13(17)16-7-5-10(15)9-16/h1-4,10H,5-9,15H2/t10-/m1/s1 |
| InChIKey | LVUVMOMEIWLOEE-SNVBAGLBSA-N |
| XLogP | 1.87 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |